C29H27Cl2N5O4S — CID 18782270
N-(3-carbamimidoylphenyl)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide (PubChem CID 18782270) has the molecular formula C29H27Cl2N5O4S and a molecular weight of 612.54 g/mol. Its IUPAC name is N-(3-carbamimidoylphenyl)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-(3-carbamimidoylphenyl)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 18782270 |
| Molecular Formula | C29H27Cl2N5O4S |
| Molecular Weight | 612.54 g/mol |
| Exact Mass | 611.12 |
| IUPAC Name | N-(3-carbamimidoylphenyl)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(NC(=O)C2CCCN2S(=O)(=O)c2ccc(Cl)c(COc3cccc4ccc(C)nc34)c2Cl)c1 |
| InChI | InChI=1S/C29H27Cl2N5O4S/c1-17-10-11-18-5-3-9-24(27(18)34-17)40-16-21-22(30)12-13-25(26(21)31)41(38,39)36-14-4-8-23(36)29(37)35-20-7-2-6-19(15-20)28(32)33/h2-3,5-7,9-13,15,23H,4,8,14,16H2,1H3,(H3,32,33)(H,35,37) |
| InChIKey | NNTUWTKWFGLWHA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 138.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|