C32H32Cl2N4O4S2 — CID 11104348
methyl 3-[[[(2S)-1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carbonyl]amino]methyl]benzenecarboximidothioate (PubChem CID 11104348) has the molecular formula C32H32Cl2N4O4S2 and a molecular weight of 671.67 g/mol. Its IUPAC name is methyl 3-[[[(2S)-1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carbonyl]amino]methyl]benzenecarboximidothioate.
| Compound Name | methyl 3-[[[(2S)-1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carbonyl]amino]methyl]benzenecarboximidothioate |
|---|---|
| PubChem CID | 11104348 |
| Molecular Formula | C32H32Cl2N4O4S2 |
| Molecular Weight | 671.67 g/mol |
| Exact Mass | 670.12 |
| IUPAC Name | methyl 3-[[[(2S)-1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carbonyl]amino]methyl]benzenecarboximidothioate |
| SMILES | [H]/N=C(\SC)c1cccc(CNC(=O)[C@@H]2CCCN2S(=O)(=O)c2ccc(Cl)c(COc3cccc4c(C)cc(C)nc34)c2Cl)c1 |
| InChI | InChI=1S/C32H32Cl2N4O4S2/c1-19-15-20(2)37-30-23(19)9-5-11-27(30)42-18-24-25(33)12-13-28(29(24)34)44(40,41)38-14-6-10-26(38)32(39)36-17-21-7-4-8-22(16-21)31(35)43-3/h4-5,7-9,11-13,15-16,26,35H,6,10,14,17-18H2,1-3H3,(H,36,39)/b35-31-/t26-/m0/s1 |
| InChIKey | QAFQDQHGLDPAMD-BQSMVRIRSA-N |
| XLogP | 6.90 |
| TPSA | 112.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.67 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|