C29H34Cl2N6O4S — CID 22008649
4-[1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carbonyl]-2,6-dimethylpiperazine-1-carboximidamide (PubChem CID 22008649) has the molecular formula C29H34Cl2N6O4S and a molecular weight of 633.60 g/mol. Its IUPAC name is 4-[1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carbonyl]-2,6-dimethylpiperazine-1-carboximidamide.
| Compound Name | 4-[1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carbonyl]-2,6-dimethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 22008649 |
| Molecular Formula | C29H34Cl2N6O4S |
| Molecular Weight | 633.60 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | 4-[1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carbonyl]-2,6-dimethylpiperazine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1C(C)CN(C(=O)C2CCCN2S(=O)(=O)c2ccc(Cl)c(COc3cccc4ccc(C)nc34)c2Cl)CC1C |
| InChI | InChI=1S/C29H34Cl2N6O4S/c1-17-9-10-20-6-4-8-24(27(20)34-17)41-16-21-22(30)11-12-25(26(21)31)42(39,40)36-13-5-7-23(36)28(38)35-14-18(2)37(29(32)33)19(3)15-35/h4,6,8-12,18-19,23H,5,7,13-16H2,1-3H3,(H3,32,33) |
| InChIKey | GBJVTVFXBYXJOB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 132.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|