C36H38Cl2N6O8S2 — CID 57214046
[[amino-[4-[4-[1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carbonyl]piperazin-1-yl]sulfonylphenyl]methylidene]amino] acetate (PubChem CID 57214046) has the molecular formula C36H38Cl2N6O8S2 and a molecular weight of 817.77 g/mol. Its IUPAC name is [[amino-[4-[4-[1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carbonyl]piperazin-1-yl]sulfonylphenyl]methylidene]amino] acetate.
| Compound Name | [[amino-[4-[4-[1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carbonyl]piperazin-1-yl]sulfonylphenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 57214046 |
| Molecular Formula | C36H38Cl2N6O8S2 |
| Molecular Weight | 817.77 g/mol |
| Exact Mass | 816.16 |
| IUPAC Name | [[amino-[4-[4-[1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carbonyl]piperazin-1-yl]sulfonylphenyl]methylidene]amino] acetate |
| SMILES | CC(=O)ON=C(N)c1ccc(S(=O)(=O)N2CCN(C(=O)C3CCCN3S(=O)(=O)c3ccc(Cl)c(COc4cccc5c(C)cc(C)nc45)c3Cl)CC2)cc1 |
| InChI | InChI=1S/C36H38Cl2N6O8S2/c1-22-20-23(2)40-34-27(22)6-4-8-31(34)51-21-28-29(37)13-14-32(33(28)38)54(49,50)44-15-5-7-30(44)36(46)42-16-18-43(19-17-42)53(47,48)26-11-9-25(10-12-26)35(39)41-52-24(3)45/h4,6,8-14,20,30H,5,7,15-19,21H2,1-3H3,(H2,39,41) |
| InChIKey | YINSYVMFPYYLFI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 181.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.77 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|