C36H38Cl2N6O5S — CID 67587635
[(2S)-1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidin-2-yl]-[4-(4-methanehydrazonoylbenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 67587635) has the molecular formula C36H38Cl2N6O5S and a molecular weight of 737.71 g/mol. Its IUPAC name is [(2S)-1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidin-2-yl]-[4-(4-methanehydrazonoylbenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | [(2S)-1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidin-2-yl]-[4-(4-methanehydrazonoylbenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 67587635 |
| Molecular Formula | C36H38Cl2N6O5S |
| Molecular Weight | 737.71 g/mol |
| Exact Mass | 736.20 |
| IUPAC Name | [(2S)-1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidin-2-yl]-[4-(4-methanehydrazonoylbenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | Cc1cc(C)c2cccc(OCc3c(Cl)ccc(S(=O)(=O)N4CCC[C@H]4C(=O)N4CCCN(C(=O)c5ccc(C=NN)cc5)CC4)c3Cl)c2n1 |
| InChI | InChI=1S/C36H38Cl2N6O5S/c1-23-20-24(2)41-34-27(23)6-3-8-31(34)49-22-28-29(37)13-14-32(33(28)38)50(47,48)44-17-4-7-30(44)36(46)43-16-5-15-42(18-19-43)35(45)26-11-9-25(10-12-26)21-40-39/h3,6,8-14,20-21,30H,4-5,7,15-19,22,39H2,1-2H3/t30-/m0/s1 |
| InChIKey | PYYCXKCFMGWREK-PMERELPUSA-N |
| XLogP | 5.56 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|