C18H15Cl2NO4S — CID 87616267
2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]benzenesulfonic acid (PubChem CID 87616267) has the molecular formula C18H15Cl2NO4S and a molecular weight of 412.29 g/mol. Its IUPAC name is 2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]benzenesulfonic acid.
| Compound Name | 2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87616267 |
| Molecular Formula | C18H15Cl2NO4S |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]benzenesulfonic acid |
| SMILES | Cc1cc(C)c2cccc(OCc3c(Cl)ccc(S(=O)(=O)O)c3Cl)c2n1 |
| InChI | InChI=1S/C18H15Cl2NO4S/c1-10-8-11(2)21-18-12(10)4-3-5-15(18)25-9-13-14(19)6-7-16(17(13)20)26(22,23)24/h3-8H,9H2,1-2H3,(H,22,23,24) |
| InChIKey | CHFUPCBBCQCPOS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|