C26H20Cl2N4O4 — CID 67656946
N-[2,4-dichloro-3-[(2-methylimidazo[1,2-a]pyridin-8-yl)oxymethyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 67656946) has the molecular formula C26H20Cl2N4O4 and a molecular weight of 523.38 g/mol. Its IUPAC name is N-[2,4-dichloro-3-[(2-methylimidazo[1,2-a]pyridin-8-yl)oxymethyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[2,4-dichloro-3-[(2-methylimidazo[1,2-a]pyridin-8-yl)oxymethyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 67656946 |
| Molecular Formula | C26H20Cl2N4O4 |
| Molecular Weight | 523.38 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | N-[2,4-dichloro-3-[(2-methylimidazo[1,2-a]pyridin-8-yl)oxymethyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | Cc1cn2cccc(OCc3c(Cl)ccc(NC(=O)C(C)N4C(=O)c5ccccc5C4=O)c3Cl)c2n1 |
| InChI | InChI=1S/C26H20Cl2N4O4/c1-14-12-31-11-5-8-21(23(31)29-14)36-13-18-19(27)9-10-20(22(18)28)30-24(33)15(2)32-25(34)16-6-3-4-7-17(16)26(32)35/h3-12,15H,13H2,1-2H3,(H,30,33) |
| InChIKey | IDQXNGCESFTFJB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|