C24H20ClN3O6S — CID 4836454
N-[2-chloro-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 4836454) has the molecular formula C24H20ClN3O6S and a molecular weight of 513.96 g/mol. Its IUPAC name is N-[2-chloro-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[2-chloro-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 4836454 |
| Molecular Formula | C24H20ClN3O6S |
| Molecular Weight | 513.96 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | N-[2-chloro-5-[(2-methoxyphenyl)sulfamoyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(Cl)c(NC(=O)C(C)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C24H20ClN3O6S/c1-14(28-23(30)16-7-3-4-8-17(16)24(28)31)22(29)26-20-13-15(11-12-18(20)25)35(32,33)27-19-9-5-6-10-21(19)34-2/h3-14,27H,1-2H3,(H,26,29) |
| InChIKey | GOUYYZGGLRRORJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.96 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|