C23H22ClN3O7S — CID 25401892
[2-(2-chloro-5-pyrrolidin-1-ylsulfonylanilino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 25401892) has the molecular formula C23H22ClN3O7S and a molecular weight of 519.96 g/mol. Its IUPAC name is [2-(2-chloro-5-pyrrolidin-1-ylsulfonylanilino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(2-chloro-5-pyrrolidin-1-ylsulfonylanilino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 25401892 |
| Molecular Formula | C23H22ClN3O7S |
| Molecular Weight | 519.96 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | [2-(2-chloro-5-pyrrolidin-1-ylsulfonylanilino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](C(=O)OCC(=O)Nc1cc(S(=O)(=O)N2CCCC2)ccc1Cl)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H22ClN3O7S/c1-14(27-21(29)16-6-2-3-7-17(16)22(27)30)23(31)34-13-20(28)25-19-12-15(8-9-18(19)24)35(32,33)26-10-4-5-11-26/h2-3,6-9,12,14H,4-5,10-11,13H2,1H3,(H,25,28)/t14-/m0/s1 |
| InChIKey | XAMUSTBTPYACMI-AWEZNQCLSA-N |
| XLogP | 2.29 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.96 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|