C28H19ClN4O4 — CID 22008953
N-[4-chloro-2-cyano-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-1,4-dioxo-2,3-dihydroisoquinoline-3-carboxamide (PubChem CID 22008953) has the molecular formula C28H19ClN4O4 and a molecular weight of 510.94 g/mol. Its IUPAC name is N-[4-chloro-2-cyano-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-1,4-dioxo-2,3-dihydroisoquinoline-3-carboxamide.
| Compound Name | N-[4-chloro-2-cyano-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-1,4-dioxo-2,3-dihydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 22008953 |
| Molecular Formula | C28H19ClN4O4 |
| Molecular Weight | 510.94 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | N-[4-chloro-2-cyano-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-1,4-dioxo-2,3-dihydroisoquinoline-3-carboxamide |
| SMILES | Cc1ccc2cccc(OCc3c(Cl)ccc(NC(=O)C4NC(=O)c5ccccc5C4=O)c3C#N)c2n1 |
| InChI | InChI=1S/C28H19ClN4O4/c1-15-9-10-16-5-4-8-23(24(16)31-15)37-14-20-19(13-30)22(12-11-21(20)29)32-28(36)25-26(34)17-6-2-3-7-18(17)27(35)33-25/h2-12,25H,14H2,1H3,(H,32,36)(H,33,35) |
| InChIKey | OWWOZLDVIBLVBR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.94 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|