C30H30N4O6 — CID 59322879
4-(2,5-dioxopyrrol-1-yl)-N-[2-[2-(10-methoxy-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-15-yl)ethyl-methylamino]ethyl]butanamide (PubChem CID 59322879) has the molecular formula C30H30N4O6 and a molecular weight of 542.59 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-N-[2-[2-(10-methoxy-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-15-yl)ethyl-methylamino]ethyl]butanamide.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-N-[2-[2-(10-methoxy-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-15-yl)ethyl-methylamino]ethyl]butanamide |
|---|---|
| PubChem CID | 59322879 |
| Molecular Formula | C30H30N4O6 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-N-[2-[2-(10-methoxy-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-15-yl)ethyl-methylamino]ethyl]butanamide |
| SMILES | COc1ccc2c3c(c4ccccc4cc13)C(=O)N(CCN(C)CCNC(=O)CCCN1C(=O)C=CC1=O)C2=O |
| InChI | InChI=1S/C30H30N4O6/c1-32(15-13-31-24(35)8-5-14-33-25(36)11-12-26(33)37)16-17-34-29(38)21-9-10-23(40-2)22-18-19-6-3-4-7-20(19)28(27(21)22)30(34)39/h3-4,6-7,9-12,18H,5,8,13-17H2,1-2H3,(H,31,35) |
| InChIKey | KNXAOGNJBULOAR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|