C18H18N2O3 — CID 68522707
N-(2-butyl-1,3-dioxobenzo[e]isoindol-5-yl)acetamide (PubChem CID 68522707) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is N-(2-butyl-1,3-dioxobenzo[e]isoindol-5-yl)acetamide.
| Compound Name | N-(2-butyl-1,3-dioxobenzo[e]isoindol-5-yl)acetamide |
|---|---|
| PubChem CID | 68522707 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-(2-butyl-1,3-dioxobenzo[e]isoindol-5-yl)acetamide |
| SMILES | CCCCN1C(=O)c2cc(NC(C)=O)c3ccccc3c2C1=O |
| InChI | InChI=1S/C18H18N2O3/c1-3-4-9-20-17(22)14-10-15(19-11(2)21)12-7-5-6-8-13(12)16(14)18(20)23/h5-8,10H,3-4,9H2,1-2H3,(H,19,21) |
| InChIKey | JVYMKAOHAOHXDS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|