C31H39N3O5Si — CID 122233012
[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl N-[2-[3-(dimethylamino)propyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]carbamate (PubChem CID 122233012) has the molecular formula C31H39N3O5Si and a molecular weight of 561.76 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl N-[2-[3-(dimethylamino)propyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]carbamate.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl N-[2-[3-(dimethylamino)propyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]carbamate |
|---|---|
| PubChem CID | 122233012 |
| Molecular Formula | C31H39N3O5Si |
| Molecular Weight | 561.76 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl N-[2-[3-(dimethylamino)propyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]carbamate |
| SMILES | CN(C)CCCN1C(=O)c2cccc3c(NC(=O)OCc4ccc(O[Si](C)(C)C(C)(C)C)cc4)ccc(c23)C1=O |
| InChI | InChI=1S/C31H39N3O5Si/c1-31(2,3)40(6,7)39-22-14-12-21(13-15-22)20-38-30(37)32-26-17-16-25-27-23(26)10-8-11-24(27)28(35)34(29(25)36)19-9-18-33(4)5/h8,10-17H,9,18-20H2,1-7H3,(H,32,37) |
| InChIKey | ODEJDOFGWGDTSU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.76 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|