C33H28N2O2 — CID 135017344
2-[2,6-di(propan-2-yl)phenyl]-6-isoquinolin-8-ylbenzo[de]isoquinoline-1,3-dione (PubChem CID 135017344) has the molecular formula C33H28N2O2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]-6-isoquinolin-8-ylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]-6-isoquinolin-8-ylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 135017344 |
| Molecular Formula | C33H28N2O2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]-6-isoquinolin-8-ylbenzo[de]isoquinoline-1,3-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)c2cccc3c(-c4cccc5ccncc45)ccc(c23)C1=O |
| InChI | InChI=1S/C33H28N2O2/c1-19(2)22-9-6-10-23(20(3)4)31(22)35-32(36)27-13-7-12-26-25(14-15-28(30(26)27)33(35)37)24-11-5-8-21-16-17-34-18-29(21)24/h5-20H,1-4H3 |
| InChIKey | XKBAIKSOTVOYOI-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|