C33H26N2O2 — CID 135017342
16-[2,6-di(propan-2-yl)phenyl]-3,16-diazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6(23),7,9,11(21),12,14(22),18-decaene-15,17-dione (PubChem CID 135017342) has the molecular formula C33H26N2O2 and a molecular weight of 482.58 g/mol. Its IUPAC name is 16-[2,6-di(propan-2-yl)phenyl]-3,16-diazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6(23),7,9,11(21),12,14(22),18-decaene-15,17-dione.
| Compound Name | 16-[2,6-di(propan-2-yl)phenyl]-3,16-diazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6(23),7,9,11(21),12,14(22),18-decaene-15,17-dione |
|---|---|
| PubChem CID | 135017342 |
| Molecular Formula | C33H26N2O2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 16-[2,6-di(propan-2-yl)phenyl]-3,16-diazahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6(23),7,9,11(21),12,14(22),18-decaene-15,17-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)c2ccc3c4cccc5ccnc(c6ccc(c2c36)C1=O)c54 |
| InChI | InChI=1S/C33H26N2O2/c1-17(2)20-8-6-9-21(18(3)4)31(20)35-32(36)25-13-11-23-22-10-5-7-19-15-16-34-30(27(19)22)24-12-14-26(33(35)37)29(25)28(23)24/h5-18H,1-4H3 |
| InChIKey | DENPJAJFYKWHRF-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|