C39H35NO2 — CID 144936127
2-[2,6-di(propan-2-yl)phenyl]-6-methyl-7-(8-methyl-5-prop-1-ynylnaphthalen-1-yl)benzo[de]isoquinoline-1,3-dione (PubChem CID 144936127) has the molecular formula C39H35NO2 and a molecular weight of 549.71 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]-6-methyl-7-(8-methyl-5-prop-1-ynylnaphthalen-1-yl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]-6-methyl-7-(8-methyl-5-prop-1-ynylnaphthalen-1-yl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 144936127 |
| Molecular Formula | C39H35NO2 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]-6-methyl-7-(8-methyl-5-prop-1-ynylnaphthalen-1-yl)benzo[de]isoquinoline-1,3-dione |
| SMILES | CC#Cc1ccc(C)c2c(-c3ccc4c5c(ccc(C)c35)C(=O)N(c3c(C(C)C)cccc3C(C)C)C4=O)cccc12 |
| InChI | InChI=1S/C39H35NO2/c1-8-11-26-18-16-24(6)34-29(26)14-10-15-30(34)31-20-21-33-36-32(19-17-25(7)35(31)36)38(41)40(39(33)42)37-27(22(2)3)12-9-13-28(37)23(4)5/h9-10,12-23H,1-7H3 |
| InChIKey | ACGHTYNDDQVODN-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|