C34H23NO2 — CID 144936114
16-(2-propan-2-ylphenyl)-5-prop-1-ynyl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11(21),12,14(22),18-decaene-15,17-dione (PubChem CID 144936114) has the molecular formula C34H23NO2 and a molecular weight of 477.56 g/mol. Its IUPAC name is 16-(2-propan-2-ylphenyl)-5-prop-1-ynyl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11(21),12,14(22),18-decaene-15,17-dione.
| Compound Name | 16-(2-propan-2-ylphenyl)-5-prop-1-ynyl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11(21),12,14(22),18-decaene-15,17-dione |
|---|---|
| PubChem CID | 144936114 |
| Molecular Formula | C34H23NO2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 16-(2-propan-2-ylphenyl)-5-prop-1-ynyl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11(21),12,14(22),18-decaene-15,17-dione |
| SMILES | CC#Cc1ccc2c3ccc4c5c(ccc(c6cccc1c62)c53)C(=O)N(c1ccccc1C(C)C)C4=O |
| InChI | InChI=1S/C34H23NO2/c1-4-8-20-13-14-24-26-16-18-28-32-27(17-15-25(31(26)32)23-11-7-10-22(20)30(23)24)33(36)35(34(28)37)29-12-6-5-9-21(29)19(2)3/h5-7,9-19H,1-3H3 |
| InChIKey | KKOWCLPFTAPYOC-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|