C28H16BrNO2 — CID 138728383
21-(4-bromo-2-nitrophenyl)pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene (PubChem CID 138728383) has the molecular formula C28H16BrNO2 and a molecular weight of 478.35 g/mol. Its IUPAC name is 21-(4-bromo-2-nitrophenyl)pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene.
| Compound Name | 21-(4-bromo-2-nitrophenyl)pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene |
|---|---|
| PubChem CID | 138728383 |
| Molecular Formula | C28H16BrNO2 |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 21-(4-bromo-2-nitrophenyl)pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1-c1cc2c3ccccc3c3ccccc3c2c2ccccc12 |
| InChI | InChI=1S/C28H16BrNO2/c29-17-13-14-22(27(15-17)30(31)32)25-16-26-20-9-2-1-7-18(20)19-8-3-5-11-23(19)28(26)24-12-6-4-10-21(24)25/h1-16H |
| InChIKey | FYJJJLYUQHSFQQ-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|