C46H39Br2N2O5P — CID 158448788
18-bromo-21-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaene;9-(4-bromo-2-nitrophenyl)phenanthrene;triethyl phosphite (PubChem CID 158448788) has the molecular formula C46H39Br2N2O5P and a molecular weight of 890.61 g/mol. Its IUPAC name is 18-bromo-21-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaene;9-(4-bromo-2-nitrophenyl)phenanthrene;triethyl phosphite.
| Compound Name | 18-bromo-21-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaene;9-(4-bromo-2-nitrophenyl)phenanthrene;triethyl phosphite |
|---|---|
| PubChem CID | 158448788 |
| Molecular Formula | C46H39Br2N2O5P |
| Molecular Weight | 890.61 g/mol |
| Exact Mass | 888.10 |
| IUPAC Name | 18-bromo-21-azapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8,10,12,15(20),16,18-decaene;9-(4-bromo-2-nitrophenyl)phenanthrene;triethyl phosphite |
| SMILES | Brc1ccc2c(c1)[nH]c1c3ccccc3c3ccccc3c21.CCOP(OCC)OCC.O=[N+]([O-])c1cc(Br)ccc1-c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C20H12BrNO2.C20H12BrN.C6H15O3P/c21-14-9-10-18(20(12-14)22(23)24)19-11-13-5-1-2-6-15(13)16-7-3-4-8-17(16)19;21-12-9-10-17-18(11-12)22-20-16-8-4-2-6-14(16)13-5-1-3-7-15(13)19(17)20;1-4-7-10(8-5-2)9-6-3/h1-12H;1-11,22H;4-6H2,1-3H3 |
| InChIKey | HDSIADGRKRLVAK-UHFFFAOYSA-N |
| XLogP | 15.04 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.61 |
| LogP ≤ 5 | 15.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|