C30H16Br2N2O4 — CID 87414674
6,12-bis(5-bromo-2-nitrophenyl)chrysene (PubChem CID 87414674) has the molecular formula C30H16Br2N2O4 and a molecular weight of 628.28 g/mol. Its IUPAC name is 6,12-bis(5-bromo-2-nitrophenyl)chrysene.
| Compound Name | 6,12-bis(5-bromo-2-nitrophenyl)chrysene |
|---|---|
| PubChem CID | 87414674 |
| Molecular Formula | C30H16Br2N2O4 |
| Molecular Weight | 628.28 g/mol |
| Exact Mass | 625.95 |
| IUPAC Name | 6,12-bis(5-bromo-2-nitrophenyl)chrysene |
| SMILES | O=[N+]([O-])c1ccc(Br)cc1-c1cc2c3ccccc3c(-c3cc(Br)ccc3[N+](=O)[O-])cc2c2ccccc12 |
| InChI | InChI=1S/C30H16Br2N2O4/c31-17-9-11-29(33(35)36)27(13-17)25-16-24-20-6-2-4-8-22(20)26(15-23(24)19-5-1-3-7-21(19)25)28-14-18(32)10-12-30(28)34(37)38/h1-16H |
| InChIKey | JBROSDGFXCKSOR-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.28 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|