C28H15BrN2O2 — CID 142323826
7-(5-bromo-2-nitrophenyl)-12-azahexacyclo[10.10.1.02,11.04,9.013,18.019,23]tricosa-1(22),2(11),3,5,7,9,13,15,17,19(23),20-undecaene (PubChem CID 142323826) has the molecular formula C28H15BrN2O2 and a molecular weight of 491.34 g/mol. Its IUPAC name is 7-(5-bromo-2-nitrophenyl)-12-azahexacyclo[10.10.1.02,11.04,9.013,18.019,23]tricosa-1(22),2(11),3,5,7,9,13,15,17,19(23),20-undecaene.
| Compound Name | 7-(5-bromo-2-nitrophenyl)-12-azahexacyclo[10.10.1.02,11.04,9.013,18.019,23]tricosa-1(22),2(11),3,5,7,9,13,15,17,19(23),20-undecaene |
|---|---|
| PubChem CID | 142323826 |
| Molecular Formula | C28H15BrN2O2 |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | 7-(5-bromo-2-nitrophenyl)-12-azahexacyclo[10.10.1.02,11.04,9.013,18.019,23]tricosa-1(22),2(11),3,5,7,9,13,15,17,19(23),20-undecaene |
| SMILES | O=[N+]([O-])c1ccc(Br)cc1-c1ccc2cc3c4cccc5c6ccccc6n(c3cc2c1)c54 |
| InChI | InChI=1S/C28H15BrN2O2/c29-19-10-11-26(31(32)33)23(15-19)17-9-8-16-13-24-22-6-3-5-21-20-4-1-2-7-25(20)30(28(21)22)27(24)14-18(16)12-17/h1-15H |
| InChIKey | PWIHYICPHQUYAU-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 47.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|