C14H5ClN2O6 — CID 154104523
2-chloro-1,3-dinitroanthracene-9,10-dione (PubChem CID 154104523) has the molecular formula C14H5ClN2O6 and a molecular weight of 332.66 g/mol. Its IUPAC name is 2-chloro-1,3-dinitroanthracene-9,10-dione.
| Compound Name | 2-chloro-1,3-dinitroanthracene-9,10-dione |
|---|---|
| PubChem CID | 154104523 |
| Molecular Formula | C14H5ClN2O6 |
| Molecular Weight | 332.66 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 2-chloro-1,3-dinitroanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc([N+](=O)[O-])c(Cl)c2[N+](=O)[O-] |
| InChI | InChI=1S/C14H5ClN2O6/c15-11-9(16(20)21)5-8-10(12(11)17(22)23)14(19)7-4-2-1-3-6(7)13(8)18/h1-5H |
| InChIKey | NMKNPNMDLWFWIN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.66 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|