C16H10N2O8 — CID 154085539
1,2-dimethoxy-3,4-dinitroanthracene-9,10-dione (PubChem CID 154085539) has the molecular formula C16H10N2O8 and a molecular weight of 358.26 g/mol. Its IUPAC name is 1,2-dimethoxy-3,4-dinitroanthracene-9,10-dione.
| Compound Name | 1,2-dimethoxy-3,4-dinitroanthracene-9,10-dione |
|---|---|
| PubChem CID | 154085539 |
| Molecular Formula | C16H10N2O8 |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 1,2-dimethoxy-3,4-dinitroanthracene-9,10-dione |
| SMILES | COc1c(OC)c([N+](=O)[O-])c([N+](=O)[O-])c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H10N2O8/c1-25-15-10-9(11(17(21)22)12(18(23)24)16(15)26-2)13(19)7-5-3-4-6-8(7)14(10)20/h3-6H,1-2H3 |
| InChIKey | FASDCSYAOMWGPH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|