C14H4Cl2N2O6 — CID 21414533
1,2-dichloro-3,4-dinitroanthracene-9,10-dione (PubChem CID 21414533) has the molecular formula C14H4Cl2N2O6 and a molecular weight of 367.10 g/mol. Its IUPAC name is 1,2-dichloro-3,4-dinitroanthracene-9,10-dione.
| Compound Name | 1,2-dichloro-3,4-dinitroanthracene-9,10-dione |
|---|---|
| PubChem CID | 21414533 |
| Molecular Formula | C14H4Cl2N2O6 |
| Molecular Weight | 367.10 g/mol |
| Exact Mass | 365.94 |
| IUPAC Name | 1,2-dichloro-3,4-dinitroanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(Cl)c(Cl)c([N+](=O)[O-])c2[N+](=O)[O-] |
| InChI | InChI=1S/C14H4Cl2N2O6/c15-9-7-8(11(17(21)22)12(10(9)16)18(23)24)14(20)6-4-2-1-3-5(6)13(7)19/h1-4H |
| InChIKey | ZUJGNFCLMPFXSJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.10 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|