C16H11NO6 — CID 3919311
1-hydroxy-4-methoxy-3-methyl-2-nitroanthracene-9,10-dione (PubChem CID 3919311) has the molecular formula C16H11NO6 and a molecular weight of 313.26 g/mol. Its IUPAC name is 1-hydroxy-4-methoxy-3-methyl-2-nitroanthracene-9,10-dione.
| Compound Name | 1-hydroxy-4-methoxy-3-methyl-2-nitroanthracene-9,10-dione |
|---|---|
| PubChem CID | 3919311 |
| Molecular Formula | C16H11NO6 |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 1-hydroxy-4-methoxy-3-methyl-2-nitroanthracene-9,10-dione |
| SMILES | COc1c(C)c([N+](=O)[O-])c(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H11NO6/c1-7-12(17(21)22)15(20)10-11(16(7)23-2)14(19)9-6-4-3-5-8(9)13(10)18/h3-6,20H,1-2H3 |
| InChIKey | JUHKCMCQUIOVST-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|