C24H23NO10 — CID 102417965
diethyl 2-[(1,4-dimethoxy-3-nitro-9,10-dioxoanthracen-2-yl)methyl]propanedioate (PubChem CID 102417965) has the molecular formula C24H23NO10 and a molecular weight of 485.45 g/mol. Its IUPAC name is diethyl 2-[(1,4-dimethoxy-3-nitro-9,10-dioxoanthracen-2-yl)methyl]propanedioate.
| Compound Name | diethyl 2-[(1,4-dimethoxy-3-nitro-9,10-dioxoanthracen-2-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 102417965 |
| Molecular Formula | C24H23NO10 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | diethyl 2-[(1,4-dimethoxy-3-nitro-9,10-dioxoanthracen-2-yl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1c(OC)c2c(c(OC)c1[N+](=O)[O-])C(=O)c1ccccc1C2=O)C(=O)OCC |
| InChI | InChI=1S/C24H23NO10/c1-5-34-23(28)15(24(29)35-6-2)11-14-18(25(30)31)22(33-4)17-16(21(14)32-3)19(26)12-9-7-8-10-13(12)20(17)27/h7-10,15H,5-6,11H2,1-4H3 |
| InChIKey | IFWAPIZFJUFEMB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 148.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|