C16H14N6O18 — CID 87251966
3,5-dimethoxy-2,4,6-trinitrophenol (PubChem CID 87251966) has the molecular formula C16H14N6O18 and a molecular weight of 578.31 g/mol. Its IUPAC name is 3,5-dimethoxy-2,4,6-trinitrophenol.
| Compound Name | 3,5-dimethoxy-2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 87251966 |
| Molecular Formula | C16H14N6O18 |
| Molecular Weight | 578.31 g/mol |
| Exact Mass | 578.04 |
| IUPAC Name | 3,5-dimethoxy-2,4,6-trinitrophenol |
| SMILES | COc1c([N+](=O)[O-])c(O)c([N+](=O)[O-])c(OC)c1[N+](=O)[O-].COc1c([N+](=O)[O-])c(O)c([N+](=O)[O-])c(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/2C8H7N3O9/c2*1-19-7-3(9(13)14)6(12)4(10(15)16)8(20-2)5(7)11(17)18/h2*12H,1-2H3 |
| InChIKey | SWLSZTBBRXOYMH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 336.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|