C17H18N2O10 — CID 71371782
2-(3,5-dimethoxy-4-nitrophenoxy)-1,3,5-trimethoxy-4-nitrobenzene (PubChem CID 71371782) has the molecular formula C17H18N2O10 and a molecular weight of 410.34 g/mol. Its IUPAC name is 2-(3,5-dimethoxy-4-nitrophenoxy)-1,3,5-trimethoxy-4-nitrobenzene.
| Compound Name | 2-(3,5-dimethoxy-4-nitrophenoxy)-1,3,5-trimethoxy-4-nitrobenzene |
|---|---|
| PubChem CID | 71371782 |
| Molecular Formula | C17H18N2O10 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2-(3,5-dimethoxy-4-nitrophenoxy)-1,3,5-trimethoxy-4-nitrobenzene |
| SMILES | COc1cc(OC)c([N+](=O)[O-])c(OC)c1Oc1cc(OC)c([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C17H18N2O10/c1-24-10-6-9(7-11(25-2)14(10)18(20)21)29-16-13(27-4)8-12(26-3)15(19(22)23)17(16)28-5/h6-8H,1-5H3 |
| InChIKey | MXAVHENAECNDDN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 141.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|