C8H9NO5 — CID 10965507
3,5-dimethoxy-2-nitrophenol (PubChem CID 10965507) has the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. Its IUPAC name is 3,5-dimethoxy-2-nitrophenol.
| Compound Name | 3,5-dimethoxy-2-nitrophenol |
|---|---|
| PubChem CID | 10965507 |
| Molecular Formula | C8H9NO5 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 3,5-dimethoxy-2-nitrophenol |
| SMILES | COc1cc(O)c([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C8H9NO5/c1-13-5-3-6(10)8(9(11)12)7(4-5)14-2/h3-4,10H,1-2H3 |
| InChIKey | RWJQMPCYEXKXIA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|