C8H6F4O4S — CID 88541716
(2,3,4,6-tetrafluoro-5-methoxyphenyl) methanesulfonate (PubChem CID 88541716) has the molecular formula C8H6F4O4S and a molecular weight of 274.19 g/mol. Its IUPAC name is (2,3,4,6-tetrafluoro-5-methoxyphenyl) methanesulfonate.
| Compound Name | (2,3,4,6-tetrafluoro-5-methoxyphenyl) methanesulfonate |
|---|---|
| PubChem CID | 88541716 |
| Molecular Formula | C8H6F4O4S |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | (2,3,4,6-tetrafluoro-5-methoxyphenyl) methanesulfonate |
| SMILES | COc1c(F)c(F)c(F)c(OS(C)(=O)=O)c1F |
| InChI | InChI=1S/C8H6F4O4S/c1-15-7-4(10)3(9)5(11)8(6(7)12)16-17(2,13)14/h1-2H3 |
| InChIKey | BILMXJABWNMKLP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|