C8H8F2O4S — CID 88541805
(2,5-difluoro-4-methoxyphenyl) methanesulfonate (PubChem CID 88541805) has the molecular formula C8H8F2O4S and a molecular weight of 238.21 g/mol. Its IUPAC name is (2,5-difluoro-4-methoxyphenyl) methanesulfonate.
| Compound Name | (2,5-difluoro-4-methoxyphenyl) methanesulfonate |
|---|---|
| PubChem CID | 88541805 |
| Molecular Formula | C8H8F2O4S |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | (2,5-difluoro-4-methoxyphenyl) methanesulfonate |
| SMILES | COc1cc(F)c(OS(C)(=O)=O)cc1F |
| InChI | InChI=1S/C8H8F2O4S/c1-13-7-3-6(10)8(4-5(7)9)14-15(2,11)12/h3-4H,1-2H3 |
| InChIKey | NYYYYIQWURVEMP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|