C14H10F4O6S2 — CID 22244797
[4-(3,5-difluoro-4-methylsulfonyloxyphenyl)-2,6-difluorophenyl] methanesulfonate (PubChem CID 22244797) has the molecular formula C14H10F4O6S2 and a molecular weight of 414.35 g/mol. Its IUPAC name is [4-(3,5-difluoro-4-methylsulfonyloxyphenyl)-2,6-difluorophenyl] methanesulfonate.
| Compound Name | [4-(3,5-difluoro-4-methylsulfonyloxyphenyl)-2,6-difluorophenyl] methanesulfonate |
|---|---|
| PubChem CID | 22244797 |
| Molecular Formula | C14H10F4O6S2 |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | [4-(3,5-difluoro-4-methylsulfonyloxyphenyl)-2,6-difluorophenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1c(F)cc(-c2cc(F)c(OS(C)(=O)=O)c(F)c2)cc1F |
| InChI | InChI=1S/C14H10F4O6S2/c1-25(19,20)23-13-9(15)3-7(4-10(13)16)8-5-11(17)14(12(18)6-8)24-26(2,21)22/h3-6H,1-2H3 |
| InChIKey | RYFUALHOSYJMKI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|