C9H11BrO3S — CID 88867193
(4-bromo-2,6-dimethylphenyl) methanesulfonate (PubChem CID 88867193) has the molecular formula C9H11BrO3S and a molecular weight of 279.16 g/mol. Its IUPAC name is (4-bromo-2,6-dimethylphenyl) methanesulfonate.
| Compound Name | (4-bromo-2,6-dimethylphenyl) methanesulfonate |
|---|---|
| PubChem CID | 88867193 |
| Molecular Formula | C9H11BrO3S |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | (4-bromo-2,6-dimethylphenyl) methanesulfonate |
| SMILES | Cc1cc(Br)cc(C)c1OS(C)(=O)=O |
| InChI | InChI=1S/C9H11BrO3S/c1-6-4-8(10)5-7(2)9(6)13-14(3,11)12/h4-5H,1-3H3 |
| InChIKey | FDNXPHHMVMAMRD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|