C10H13IO4S — CID 139864609
(2-iodo-6-methoxy-3,4-dimethylphenyl) methanesulfonate (PubChem CID 139864609) has the molecular formula C10H13IO4S and a molecular weight of 356.18 g/mol. Its IUPAC name is (2-iodo-6-methoxy-3,4-dimethylphenyl) methanesulfonate.
| Compound Name | (2-iodo-6-methoxy-3,4-dimethylphenyl) methanesulfonate |
|---|---|
| PubChem CID | 139864609 |
| Molecular Formula | C10H13IO4S |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | (2-iodo-6-methoxy-3,4-dimethylphenyl) methanesulfonate |
| SMILES | COc1cc(C)c(C)c(I)c1OS(C)(=O)=O |
| InChI | InChI=1S/C10H13IO4S/c1-6-5-8(14-3)10(9(11)7(6)2)15-16(4,12)13/h5H,1-4H3 |
| InChIKey | CSBXLELCOCXEQL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|