About 3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate
3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate (PubChem CID 159278397) has the molecular formula C19H26O8S
and a molecular weight of 414.48 g/mol. Its IUPAC name is 3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate.
Molecular Properties
| Compound Name | 3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate |
| PubChem CID | 159278397 |
| Molecular Formula | C19H26O8S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate |
| SMILES | COc1cc(O)cc(OC)c1C.COc1cc(OS(C)(=O)=O)cc(OC)c1C |
| InChI | InChI=1S/C10H14O5S.C9H12O3/c1-7-9(13-2)5-8(6-10(7)14-3)15-16(4,11)12;1-6-8(11-2)4-7(10)5-9(6)12-3/h5-6H,1-4H3;4-5,10H,1-3H3 |
| InChIKey | KYPIEGYAIAZOLL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate?
The IUPAC name of 3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate (CID 159278397) is 3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate.
What is the SMILES notation for 3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate?
The canonical SMILES for 3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate is COc1cc(O)cc(OC)c1C.COc1cc(OS(C)(=O)=O)cc(OC)c1C.
What is the InChIKey of 3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate?
The InChIKey is KYPIEGYAIAZOLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O5S.C9H12O3/c1-7-9(13-2)5-8(6-10(7)14-3)15-16(4,11)12;1-6-8(11-2)4-7(10)5-9(6)12-3/h5-6H,1-4H3;4-5,10H,1-3H3.
What are the key properties of 3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate?
3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate has a molecular weight of 414.48 g/mol, XLogP of 3.07, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethoxy-4-methylphenol;(3,5-dimethoxy-4-methylphenyl) methanesulfonate is sourced from PubChem (CID 159278397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).