C12H20ClNO4S — CID 86611659
[5-(2-aminopropyl)-4-methoxy-2-methylphenyl] methanesulfonate;hydrochloride (PubChem CID 86611659) has the molecular formula C12H20ClNO4S and a molecular weight of 309.82 g/mol. Its IUPAC name is [5-(2-aminopropyl)-4-methoxy-2-methylphenyl] methanesulfonate;hydrochloride.
| Compound Name | [5-(2-aminopropyl)-4-methoxy-2-methylphenyl] methanesulfonate;hydrochloride |
|---|---|
| PubChem CID | 86611659 |
| Molecular Formula | C12H20ClNO4S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | [5-(2-aminopropyl)-4-methoxy-2-methylphenyl] methanesulfonate;hydrochloride |
| SMILES | COc1cc(C)c(OS(C)(=O)=O)cc1CC(C)N.Cl |
| InChI | InChI=1S/C12H19NO4S.ClH/c1-8-5-12(16-3)10(6-9(2)13)7-11(8)17-18(4,14)15;/h5,7,9H,6,13H2,1-4H3;1H |
| InChIKey | LBVWZGBWVDGECS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|