C8H6Br2O — CID 102195216
2,4-dibromo-6-methylbenzaldehyde (PubChem CID 102195216) has the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. Its IUPAC name is 2,4-dibromo-6-methylbenzaldehyde.
| Compound Name | 2,4-dibromo-6-methylbenzaldehyde |
|---|---|
| PubChem CID | 102195216 |
| Molecular Formula | C8H6Br2O |
| Molecular Weight | 277.94 g/mol |
| Exact Mass | 275.88 |
| IUPAC Name | 2,4-dibromo-6-methylbenzaldehyde |
| SMILES | Cc1cc(Br)cc(Br)c1C=O |
| InChI | InChI=1S/C8H6Br2O/c1-5-2-6(9)3-8(10)7(5)4-11/h2-4H,1H3 |
| InChIKey | XLZRSETWCJMHGI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.94 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|