C15H12Br4O — CID 162025130
2,6-dibromo-4-methylbenzaldehyde;1,3-dibromo-5-methylbenzene (PubChem CID 162025130) has the molecular formula C15H12Br4O and a molecular weight of 527.88 g/mol. Its IUPAC name is 2,6-dibromo-4-methylbenzaldehyde;1,3-dibromo-5-methylbenzene.
| Compound Name | 2,6-dibromo-4-methylbenzaldehyde;1,3-dibromo-5-methylbenzene |
|---|---|
| PubChem CID | 162025130 |
| Molecular Formula | C15H12Br4O |
| Molecular Weight | 527.88 g/mol |
| Exact Mass | 523.76 |
| IUPAC Name | 2,6-dibromo-4-methylbenzaldehyde;1,3-dibromo-5-methylbenzene |
| SMILES | Cc1cc(Br)c(C=O)c(Br)c1.Cc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C8H6Br2O.C7H6Br2/c1-5-2-7(9)6(4-11)8(10)3-5;1-5-2-6(8)4-7(9)3-5/h2-4H,1H3;2-4H,1H3 |
| InChIKey | YVGRHOGPCIXDCJ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.88 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|