C10H13BrO3 — CID 175049873
3-bromo-5-methylbenzaldehyde;ethane-1,2-diol (PubChem CID 175049873) has the molecular formula C10H13BrO3 and a molecular weight of 261.12 g/mol. Its IUPAC name is 3-bromo-5-methylbenzaldehyde;ethane-1,2-diol.
| Compound Name | 3-bromo-5-methylbenzaldehyde;ethane-1,2-diol |
|---|---|
| PubChem CID | 175049873 |
| Molecular Formula | C10H13BrO3 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 3-bromo-5-methylbenzaldehyde;ethane-1,2-diol |
| SMILES | Cc1cc(Br)cc(C=O)c1.OCCO |
| InChI | InChI=1S/C8H7BrO.C2H6O2/c1-6-2-7(5-10)4-8(9)3-6;3-1-2-4/h2-5H,1H3;3-4H,1-2H2 |
| InChIKey | XCTZGMIXNAOUNW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|