About 1-bromo-3,5-dimethylbenzene;ethane
1-bromo-3,5-dimethylbenzene;ethane (PubChem CID 144646164) has the molecular formula C12H21Br
and a molecular weight of 245.20 g/mol. Its IUPAC name is 1-bromo-3,5-dimethylbenzene;ethane.
Molecular Properties
| Compound Name | 1-bromo-3,5-dimethylbenzene;ethane |
| PubChem CID | 144646164 |
| Molecular Formula | C12H21Br |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-bromo-3,5-dimethylbenzene;ethane |
| SMILES | CC.CC.Cc1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C8H9Br.2C2H6/c1-6-3-7(2)5-8(9)4-6;2*1-2/h3-5H,1-2H3;2*1-2H3 |
| InChIKey | OCGCRHBQWLAEDE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-3,5-dimethylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3,5-dimethylbenzene;ethane?
The IUPAC name of 1-bromo-3,5-dimethylbenzene;ethane (CID 144646164) is 1-bromo-3,5-dimethylbenzene;ethane.
What is the SMILES notation for 1-bromo-3,5-dimethylbenzene;ethane?
The canonical SMILES for 1-bromo-3,5-dimethylbenzene;ethane is CC.CC.Cc1cc(C)cc(Br)c1.
What is the InChIKey of 1-bromo-3,5-dimethylbenzene;ethane?
The InChIKey is OCGCRHBQWLAEDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Br.2C2H6/c1-6-3-7(2)5-8(9)4-6;2*1-2/h3-5H,1-2H3;2*1-2H3.
What are the key properties of 1-bromo-3,5-dimethylbenzene;ethane?
1-bromo-3,5-dimethylbenzene;ethane has a molecular weight of 245.20 g/mol, XLogP of 5.12, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3,5-dimethylbenzene;ethane is sourced from PubChem (CID 144646164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).