C16H20BBrO2 — CID 54402818
1-bromo-3,5-dimethylbenzene;(3,5-dimethylphenyl)boronic acid (PubChem CID 54402818) has the molecular formula C16H20BBrO2 and a molecular weight of 335.05 g/mol. Its IUPAC name is 1-bromo-3,5-dimethylbenzene;(3,5-dimethylphenyl)boronic acid.
| Compound Name | 1-bromo-3,5-dimethylbenzene;(3,5-dimethylphenyl)boronic acid |
|---|---|
| PubChem CID | 54402818 |
| Molecular Formula | C16H20BBrO2 |
| Molecular Weight | 335.05 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1-bromo-3,5-dimethylbenzene;(3,5-dimethylphenyl)boronic acid |
| SMILES | Cc1cc(C)cc(B(O)O)c1.Cc1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C8H11BO2.C8H9Br/c1-6-3-7(2)5-8(4-6)9(10)11;1-6-3-7(2)5-8(9)4-6/h3-5,10-11H,1-2H3;3-5H,1-2H3 |
| InChIKey | VOQBRZAAMVRQLI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.05 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|