[3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid

C15H15BBrNO3 — CID 99738197

IUPAC[3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid
SMILESCc1cc(C)cc(NC(=O)c2cc(Br)cc(B(O)O)c2)c1
InChIInChI=1S/C15H15BBrNO3/c1-9-3-10(2)5-14(4-9)18-15(19)11-6-12(16(20)21)8-13(17)7-11/h3-8,20-21H,1-2H3,(H,18,19)
InChIKeyNZCQBGZQRAAVME-UHFFFAOYSA-N
MW348.01 g/mol
LogP2.00
Rot. Bonds3

About [3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid

[3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid (PubChem CID 99738197) has the molecular formula C15H15BBrNO3 and a molecular weight of 348.01 g/mol. Its IUPAC name is [3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid.

Molecular Properties

Compound Name[3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid
PubChem CID99738197
Molecular FormulaC15H15BBrNO3
Molecular Weight348.01 g/mol
Exact Mass347.03
IUPAC Name[3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid
SMILESCc1cc(C)cc(NC(=O)c2cc(Br)cc(B(O)O)c2)c1
InChIInChI=1S/C15H15BBrNO3/c1-9-3-10(2)5-14(4-9)18-15(19)11-6-12(16(20)21)8-13(17)7-11/h3-8,20-21H,1-2H3,(H,18,19)
InChIKeyNZCQBGZQRAAVME-UHFFFAOYSA-N
XLogP2.00
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500348.01
LogP ≤ 52.00
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid?
The IUPAC name of [3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid (CID 99738197) is [3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid.
What is the SMILES notation for [3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid?
The canonical SMILES for [3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid is Cc1cc(C)cc(NC(=O)c2cc(Br)cc(B(O)O)c2)c1.
What is the InChIKey of [3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid?
The InChIKey is NZCQBGZQRAAVME-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BBrNO3/c1-9-3-10(2)5-14(4-9)18-15(19)11-6-12(16(20)21)8-13(17)7-11/h3-8,20-21H,1-2H3,(H,18,19).
What are the key properties of [3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid?
[3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid has a molecular weight of 348.01 g/mol, XLogP of 2.00, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid is sourced from PubChem (CID 99738197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).