C15H15BBrNO3 — CID 99738197
[3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid (PubChem CID 99738197) has the molecular formula C15H15BBrNO3 and a molecular weight of 348.01 g/mol. Its IUPAC name is [3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid.
| Compound Name | [3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 99738197 |
| Molecular Formula | C15H15BBrNO3 |
| Molecular Weight | 348.01 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | [3-bromo-5-[(3,5-dimethylphenyl)carbamoyl]phenyl]boronic acid |
| SMILES | Cc1cc(C)cc(NC(=O)c2cc(Br)cc(B(O)O)c2)c1 |
| InChI | InChI=1S/C15H15BBrNO3/c1-9-3-10(2)5-14(4-9)18-15(19)11-6-12(16(20)21)8-13(17)7-11/h3-8,20-21H,1-2H3,(H,18,19) |
| InChIKey | NZCQBGZQRAAVME-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.01 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|