C24H24BBr2IN4O2 — CID 161456336
5-bromo-2-(3,5-dimethylphenyl)pyrimidine;5-bromo-2-iodopyrimidine;(3,5-dimethylphenyl)boronic acid (PubChem CID 161456336) has the molecular formula C24H24BBr2IN4O2 and a molecular weight of 698.01 g/mol. Its IUPAC name is 5-bromo-2-(3,5-dimethylphenyl)pyrimidine;5-bromo-2-iodopyrimidine;(3,5-dimethylphenyl)boronic acid.
| Compound Name | 5-bromo-2-(3,5-dimethylphenyl)pyrimidine;5-bromo-2-iodopyrimidine;(3,5-dimethylphenyl)boronic acid |
|---|---|
| PubChem CID | 161456336 |
| Molecular Formula | C24H24BBr2IN4O2 |
| Molecular Weight | 698.01 g/mol |
| Exact Mass | 695.94 |
| IUPAC Name | 5-bromo-2-(3,5-dimethylphenyl)pyrimidine;5-bromo-2-iodopyrimidine;(3,5-dimethylphenyl)boronic acid |
| SMILES | Brc1cnc(I)nc1.Cc1cc(C)cc(-c2ncc(Br)cn2)c1.Cc1cc(C)cc(B(O)O)c1 |
| InChI | InChI=1S/C12H11BrN2.C8H11BO2.C4H2BrIN2/c1-8-3-9(2)5-10(4-8)12-14-6-11(13)7-15-12;1-6-3-7(2)5-8(4-6)9(10)11;5-3-1-7-4(6)8-2-3/h3-7H,1-2H3;3-5,10-11H,1-2H3;1-2H |
| InChIKey | WBEWPYDWYDWWGZ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.01 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|