About 1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene
1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene (PubChem CID 144805202) has the molecular formula C12H19BrS
and a molecular weight of 275.26 g/mol. Its IUPAC name is 1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene.
Molecular Properties
| Compound Name | 1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene |
| PubChem CID | 144805202 |
| Molecular Formula | C12H19BrS |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene |
| SMILES | C=C.CC.CSc1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C8H9BrS.C2H6.C2H4/c1-6-3-7(9)5-8(4-6)10-2;2*1-2/h3-5H,1-2H3;1-2H3;1-2H2 |
| InChIKey | FIJRDYMWMJJORI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene?
The IUPAC name of 1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene (CID 144805202) is 1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene.
What is the SMILES notation for 1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene?
The canonical SMILES for 1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene is C=C.CC.CSc1cc(C)cc(Br)c1.
What is the InChIKey of 1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene?
The InChIKey is FIJRDYMWMJJORI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrS.C2H6.C2H4/c1-6-3-7(9)5-8(4-6)10-2;2*1-2/h3-5H,1-2H3;1-2H3;1-2H2.
What are the key properties of 1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene?
1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene has a molecular weight of 275.26 g/mol, XLogP of 5.31, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-methyl-5-methylsulfanylbenzene;ethane;ethene is sourced from PubChem (CID 144805202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).