C9H8BrClO — CID 84737534
3-bromo-5-chloro-2,6-dimethylbenzaldehyde (PubChem CID 84737534) has the molecular formula C9H8BrClO and a molecular weight of 247.52 g/mol. Its IUPAC name is 3-bromo-5-chloro-2,6-dimethylbenzaldehyde.
| Compound Name | 3-bromo-5-chloro-2,6-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 84737534 |
| Molecular Formula | C9H8BrClO |
| Molecular Weight | 247.52 g/mol |
| Exact Mass | 245.94 |
| IUPAC Name | 3-bromo-5-chloro-2,6-dimethylbenzaldehyde |
| SMILES | Cc1c(Cl)cc(Br)c(C)c1C=O |
| InChI | InChI=1S/C9H8BrClO/c1-5-7(4-12)6(2)9(11)3-8(5)10/h3-4H,1-2H3 |
| InChIKey | AGNBXGYWHFNXCN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|