About 2,4-dibromo-6-methylaniline;dihydrobromide
2,4-dibromo-6-methylaniline;dihydrobromide (PubChem CID 175177436) has the molecular formula C7H9Br4N
and a molecular weight of 426.77 g/mol. Its IUPAC name is 2,4-dibromo-6-methylaniline;dihydrobromide.
Molecular Properties
| Compound Name | 2,4-dibromo-6-methylaniline;dihydrobromide |
| PubChem CID | 175177436 |
| Molecular Formula | C7H9Br4N |
| Molecular Weight | 426.77 g/mol |
| Exact Mass | 422.75 |
| IUPAC Name | 2,4-dibromo-6-methylaniline;dihydrobromide |
| SMILES | Br.Br.Cc1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C7H7Br2N.2BrH/c1-4-2-5(8)3-6(9)7(4)10;;/h2-3H,10H2,1H3;2*1H |
| InChIKey | IDEVRIQNHRPWKU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.77 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromo-6-methylaniline;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-6-methylaniline;dihydrobromide?
The IUPAC name of 2,4-dibromo-6-methylaniline;dihydrobromide (CID 175177436) is 2,4-dibromo-6-methylaniline;dihydrobromide.
What is the SMILES notation for 2,4-dibromo-6-methylaniline;dihydrobromide?
The canonical SMILES for 2,4-dibromo-6-methylaniline;dihydrobromide is Br.Br.Cc1cc(Br)cc(Br)c1N.
What is the InChIKey of 2,4-dibromo-6-methylaniline;dihydrobromide?
The InChIKey is IDEVRIQNHRPWKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Br2N.2BrH/c1-4-2-5(8)3-6(9)7(4)10;;/h2-3H,10H2,1H3;2*1H.
What are the key properties of 2,4-dibromo-6-methylaniline;dihydrobromide?
2,4-dibromo-6-methylaniline;dihydrobromide has a molecular weight of 426.77 g/mol, XLogP of 4.26, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-6-methylaniline;dihydrobromide is sourced from PubChem (CID 175177436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).