C8H7Br2NO — CID 168652451
N-(2,4-dibromo-6-methylphenyl)formamide (PubChem CID 168652451) has the molecular formula C8H7Br2NO and a molecular weight of 292.96 g/mol. Its IUPAC name is N-(2,4-dibromo-6-methylphenyl)formamide.
| Compound Name | N-(2,4-dibromo-6-methylphenyl)formamide |
|---|---|
| PubChem CID | 168652451 |
| Molecular Formula | C8H7Br2NO |
| Molecular Weight | 292.96 g/mol |
| Exact Mass | 290.89 |
| IUPAC Name | N-(2,4-dibromo-6-methylphenyl)formamide |
| SMILES | Cc1cc(Br)cc(Br)c1NC=O |
| InChI | InChI=1S/C8H7Br2NO/c1-5-2-6(9)3-7(10)8(5)11-4-12/h2-4H,1H3,(H,11,12) |
| InChIKey | RIHCZKSRUBJXIT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.96 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|