C11H9BrN2O — CID 163277837
N-(6-bromo-7-methylisoquinolin-3-yl)formamide (PubChem CID 163277837) has the molecular formula C11H9BrN2O and a molecular weight of 265.11 g/mol. Its IUPAC name is N-(6-bromo-7-methylisoquinolin-3-yl)formamide.
| Compound Name | N-(6-bromo-7-methylisoquinolin-3-yl)formamide |
|---|---|
| PubChem CID | 163277837 |
| Molecular Formula | C11H9BrN2O |
| Molecular Weight | 265.11 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | N-(6-bromo-7-methylisoquinolin-3-yl)formamide |
| SMILES | Cc1cc2cnc(NC=O)cc2cc1Br |
| InChI | InChI=1S/C11H9BrN2O/c1-7-2-9-5-13-11(14-6-15)4-8(9)3-10(7)12/h2-6H,1H3,(H,13,14,15) |
| InChIKey | SPTIVPZPAOEQQJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.11 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|