C15H12N4O2 — CID 166123529
N-[3-(4-methyl-3-pyridinyl)-2-oxo-1H-1,6-naphthyridin-7-yl]formamide (PubChem CID 166123529) has the molecular formula C15H12N4O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is N-[3-(4-methyl-3-pyridinyl)-2-oxo-1H-1,6-naphthyridin-7-yl]formamide.
| Compound Name | N-[3-(4-methyl-3-pyridinyl)-2-oxo-1H-1,6-naphthyridin-7-yl]formamide |
|---|---|
| PubChem CID | 166123529 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-[3-(4-methyl-3-pyridinyl)-2-oxo-1H-1,6-naphthyridin-7-yl]formamide |
| SMILES | Cc1ccncc1-c1cc2cnc(NC=O)cc2[nH]c1=O |
| InChI | InChI=1S/C15H12N4O2/c1-9-2-3-16-7-12(9)11-4-10-6-17-14(18-8-20)5-13(10)19-15(11)21/h2-8H,1H3,(H,19,21)(H,17,18,20) |
| InChIKey | VITXHRITLWWRIK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|