C22H22N4O2 — CID 171555681
N-[6-cyano-7-[(2E,4Z,7Z)-7-hydroxyimino-4-methyl-6-methylidenenona-2,4-dien-3-yl]isoquinolin-3-yl]formamide (PubChem CID 171555681) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[6-cyano-7-[(2E,4Z,7Z)-7-hydroxyimino-4-methyl-6-methylidenenona-2,4-dien-3-yl]isoquinolin-3-yl]formamide.
| Compound Name | N-[6-cyano-7-[(2E,4Z,7Z)-7-hydroxyimino-4-methyl-6-methylidenenona-2,4-dien-3-yl]isoquinolin-3-yl]formamide |
|---|---|
| PubChem CID | 171555681 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-[6-cyano-7-[(2E,4Z,7Z)-7-hydroxyimino-4-methyl-6-methylidenenona-2,4-dien-3-yl]isoquinolin-3-yl]formamide |
| SMILES | C=C(/C=C(C)\C(=C/C)c1cc2cnc(NC=O)cc2cc1C#N)/C(CC)=N\O |
| InChI | InChI=1S/C22H22N4O2/c1-5-19(14(3)7-15(4)21(6-2)26-28)20-9-18-12-24-22(25-13-27)10-16(18)8-17(20)11-23/h5,7-10,12-13,28H,4,6H2,1-3H3,(H,24,25,27)/b14-7-,19-5+,26-21- |
| InChIKey | GVHOHJASDFDIND-JDCRSWOXSA-N |
| XLogP | 4.82 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|